C20H38O6Si — CID 71732318
ethyl (5S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methyl-3-oxonon-8-enoate (PubChem CID 71732318) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methyl-3-oxonon-8-enoate.
| Compound Name | ethyl (5S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methyl-3-oxonon-8-enoate |
|---|---|
| PubChem CID | 71732318 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | ethyl (5S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methyl-3-oxonon-8-enoate |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](CC(=O)CC(=O)OCC)OCOC |
| InChI | InChI=1S/C20H38O6Si/c1-10-17(26-27(8,9)20(4,5)6)15(3)18(25-14-23-7)12-16(21)13-19(22)24-11-2/h10,15,17-18H,1,11-14H2,2-9H3/t15-,17-,18-/m0/s1 |
| InChIKey | AMVOHGAUYYRZCY-SZMVWBNQSA-N |
| XLogP | 4.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|