C22H42O5Si2 — CID 10252824
methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-methyl-5-trimethylsilyloxydec-9-enoate (PubChem CID 10252824) has the molecular formula C22H42O5Si2 and a molecular weight of 442.75 g/mol. Its IUPAC name is methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-methyl-5-trimethylsilyloxydec-9-enoate.
| Compound Name | methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-methyl-5-trimethylsilyloxydec-9-enoate |
|---|---|
| PubChem CID | 10252824 |
| Molecular Formula | C22H42O5Si2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-methyl-5-trimethylsilyloxydec-9-enoate |
| SMILES | C=CC[C@@H](C)C[C@@H](O[Si](C)(C)C)C(=C=C(OCC)O[Si](C)(C)C)CCC(=O)OC |
| InChI | InChI=1S/C22H42O5Si2/c1-11-13-18(3)16-20(26-28(5,6)7)19(14-15-21(23)24-4)17-22(25-12-2)27-29(8,9)10/h11,18,20H,1,12-16H2,2-10H3/t17?,18-,20-/m1/s1 |
| InChIKey | LIWKONCXYLTYFV-PGDXBAMXSA-N |
| XLogP | 6.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|