C25H48O5Si2 — CID 10390635
methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7,11-dimethyl-5-trimethylsilyloxydodec-10-enoate (PubChem CID 10390635) has the molecular formula C25H48O5Si2 and a molecular weight of 484.83 g/mol. Its IUPAC name is methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7,11-dimethyl-5-trimethylsilyloxydodec-10-enoate.
| Compound Name | methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7,11-dimethyl-5-trimethylsilyloxydodec-10-enoate |
|---|---|
| PubChem CID | 10390635 |
| Molecular Formula | C25H48O5Si2 |
| Molecular Weight | 484.83 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | methyl (5R,7R)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7,11-dimethyl-5-trimethylsilyloxydodec-10-enoate |
| SMILES | CCOC(=C=C(CCC(=O)OC)[C@@H](C[C@H](C)CCC=C(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H48O5Si2/c1-12-28-25(30-32(9,10)11)19-22(16-17-24(26)27-5)23(29-31(6,7)8)18-21(4)15-13-14-20(2)3/h14,21,23H,12-13,15-18H2,1-11H3/t19?,21-,23-/m1/s1 |
| InChIKey | XUJGZHYABFXEOK-LNEVTVKDSA-N |
| XLogP | 7.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.83 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|