C26H48O7Si2 — CID 10324674
dimethyl (Z,4R,6R)-7-(2-ethoxy-2-trimethylsilyloxyethenylidene)-3-methyl-4-propan-2-yl-6-trimethylsilyloxydec-2-enedioate (PubChem CID 10324674) has the molecular formula C26H48O7Si2 and a molecular weight of 528.84 g/mol. Its IUPAC name is dimethyl (Z,4R,6R)-7-(2-ethoxy-2-trimethylsilyloxyethenylidene)-3-methyl-4-propan-2-yl-6-trimethylsilyloxydec-2-enedioate.
| Compound Name | dimethyl (Z,4R,6R)-7-(2-ethoxy-2-trimethylsilyloxyethenylidene)-3-methyl-4-propan-2-yl-6-trimethylsilyloxydec-2-enedioate |
|---|---|
| PubChem CID | 10324674 |
| Molecular Formula | C26H48O7Si2 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | dimethyl (Z,4R,6R)-7-(2-ethoxy-2-trimethylsilyloxyethenylidene)-3-methyl-4-propan-2-yl-6-trimethylsilyloxydec-2-enedioate |
| SMILES | CCOC(=C=C(CCC(=O)OC)[C@@H](C[C@@H](/C(C)=C\C(=O)OC)C(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H48O7Si2/c1-13-31-26(33-35(10,11)12)17-21(14-15-24(27)29-5)23(32-34(7,8)9)18-22(19(2)3)20(4)16-25(28)30-6/h16,19,22-23H,13-15,18H2,1-12H3/b20-16-/t17?,22-,23-/m1/s1 |
| InChIKey | DBONDERBEPKLPV-KZZPGJJSSA-N |
| XLogP | 6.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|