C21H34O6Si — CID 10024567
methyl 2-[(Z,1R,3R)-6-methoxy-4-methyl-6-oxo-3-propan-2-yl-1-trimethylsilyloxyhex-4-enyl]-5-oxocyclopentene-1-carboxylate (PubChem CID 10024567) has the molecular formula C21H34O6Si and a molecular weight of 410.58 g/mol. Its IUPAC name is methyl 2-[(Z,1R,3R)-6-methoxy-4-methyl-6-oxo-3-propan-2-yl-1-trimethylsilyloxyhex-4-enyl]-5-oxocyclopentene-1-carboxylate.
| Compound Name | methyl 2-[(Z,1R,3R)-6-methoxy-4-methyl-6-oxo-3-propan-2-yl-1-trimethylsilyloxyhex-4-enyl]-5-oxocyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 10024567 |
| Molecular Formula | C21H34O6Si |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl 2-[(Z,1R,3R)-6-methoxy-4-methyl-6-oxo-3-propan-2-yl-1-trimethylsilyloxyhex-4-enyl]-5-oxocyclopentene-1-carboxylate |
| SMILES | COC(=O)/C=C(/C)[C@H](C[C@@H](O[Si](C)(C)C)C1=C(C(=O)OC)C(=O)CC1)C(C)C |
| InChI | InChI=1S/C21H34O6Si/c1-13(2)16(14(3)11-19(23)25-4)12-18(27-28(6,7)8)15-9-10-17(22)20(15)21(24)26-5/h11,13,16,18H,9-10,12H2,1-8H3/b14-11-/t16-,18-/m1/s1 |
| InChIKey | BDRIELLSLUXMRN-HIROUSEGSA-N |
| XLogP | 3.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|