C16H26O4Si — CID 13055680
methyl (E)-7-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hept-2-enoate (PubChem CID 13055680) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is methyl (E)-7-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hept-2-enoate.
| Compound Name | methyl (E)-7-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hept-2-enoate |
|---|---|
| PubChem CID | 13055680 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl (E)-7-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hept-2-enoate |
| SMILES | COC(=O)/C=C/CCCCC1=CC(O[Si](C)(C)C)CC1=O |
| InChI | InChI=1S/C16H26O4Si/c1-19-16(18)10-8-6-5-7-9-13-11-14(12-15(13)17)20-21(2,3)4/h8,10-11,14H,5-7,9,12H2,1-4H3/b10-8+ |
| InChIKey | XVPXNNGZKAPHQP-CSKARUKUSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|