C27H46O6Si — CID 134839306
(6R)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-(3-methylbut-2-enyl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione (PubChem CID 134839306) has the molecular formula C27H46O6Si and a molecular weight of 494.75 g/mol. Its IUPAC name is (6R)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-(3-methylbut-2-enyl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione.
| Compound Name | (6R)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-(3-methylbut-2-enyl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione |
|---|---|
| PubChem CID | 134839306 |
| Molecular Formula | C27H46O6Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | (6R)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-(3-methylbut-2-enyl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione |
| SMILES | CC(C)=CCC(C(=O)CC1=CC(=O)OC(C)(C)O1)C(=O)C[C@@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H46O6Si/c1-17(2)12-13-23(25(29)15-22-16-26(30)32-27(10,11)31-22)24(28)14-21(9)33-34(18(3)4,19(5)6)20(7)8/h12,16,18-21,23H,13-15H2,1-11H3/t21-,23?/m1/s1 |
| InChIKey | IAGSVBINBJTYAY-FKHAVUOCSA-N |
| XLogP | 6.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|