C26H42O8Si — CID 56649932
prop-2-enyl (5S)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 56649932) has the molecular formula C26H42O8Si and a molecular weight of 510.70 g/mol. Its IUPAC name is prop-2-enyl (5S)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | prop-2-enyl (5S)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 56649932 |
| Molecular Formula | C26H42O8Si |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | prop-2-enyl (5S)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | C=CCOC(=O)C(C(=O)CC1=CC(=O)OC(C)(C)O1)C(=O)C[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H42O8Si/c1-11-12-31-25(30)24(22(28)14-20-15-23(29)33-26(9,10)32-20)21(27)13-19(8)34-35(16(2)3,17(4)5)18(6)7/h11,15-19,24H,1,12-14H2,2-10H3/t19-,24?/m0/s1 |
| InChIKey | LBBNETSWMDSHJI-XGLRFROISA-N |
| XLogP | 5.02 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|