C19H34O4Si — CID 134855617
tert-butyl (2E)-2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxocyclohexylidene]acetate (PubChem CID 134855617) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is tert-butyl (2E)-2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxocyclohexylidene]acetate.
| Compound Name | tert-butyl (2E)-2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxocyclohexylidene]acetate |
|---|---|
| PubChem CID | 134855617 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | tert-butyl (2E)-2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxocyclohexylidene]acetate |
| SMILES | CC1C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C/C1=C\C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-13-14(11-17(21)22-18(2,3)4)10-15(12-16(13)20)23-24(8,9)19(5,6)7/h11,13,15H,10,12H2,1-9H3/b14-11+/t13?,15-/m1/s1 |
| InChIKey | IYAAKJWIARCPQQ-QTVXHFNTSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|