C26H46O6Si — CID 11397530
methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate (PubChem CID 11397530) has the molecular formula C26H46O6Si and a molecular weight of 482.73 g/mol. Its IUPAC name is methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate.
| Compound Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 11397530 |
| Molecular Formula | C26H46O6Si |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate |
| SMILES | COC(=O)/C(C)=C/C[C@@H](C[C@@H]1C=CC[C@@H](C[C@H](OC)[C@@H](C)C(C)=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O6Si/c1-18(25(28)30-8)14-15-23(32-33(9,10)26(4,5)6)16-21-12-11-13-22(31-21)17-24(29-7)19(2)20(3)27/h11-12,14,19,21-24H,13,15-17H2,1-10H3/b18-14+/t19-,21-,22-,23-,24-/m0/s1 |
| InChIKey | MLVZESUXAHRFDZ-QTDQUAHTSA-N |
| XLogP | 5.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|