C32H60O5Si2 — CID 15602517
(3R,4S,5S,7E,9R,10S,11R,12E,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-3,5,9,11,13-pentamethyl-1-oxacyclotetradeca-7,12-diene-2,6-dione (PubChem CID 15602517) has the molecular formula C32H60O5Si2 and a molecular weight of 581.00 g/mol. Its IUPAC name is (3R,4S,5S,7E,9R,10S,11R,12E,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-3,5,9,11,13-pentamethyl-1-oxacyclotetradeca-7,12-diene-2,6-dione.
| Compound Name | (3R,4S,5S,7E,9R,10S,11R,12E,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-3,5,9,11,13-pentamethyl-1-oxacyclotetradeca-7,12-diene-2,6-dione |
|---|---|
| PubChem CID | 15602517 |
| Molecular Formula | C32H60O5Si2 |
| Molecular Weight | 581.00 g/mol |
| Exact Mass | 580.40 |
| IUPAC Name | (3R,4S,5S,7E,9R,10S,11R,12E,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-3,5,9,11,13-pentamethyl-1-oxacyclotetradeca-7,12-diene-2,6-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)/C=C/[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/1C |
| InChI | InChI=1S/C32H60O5Si2/c1-17-27-22(3)20-23(4)28(36-38(13,14)31(7,8)9)21(2)18-19-26(33)24(5)29(25(6)30(34)35-27)37-39(15,16)32(10,11)12/h18-21,23-25,27-29H,17H2,1-16H3/b19-18+,22-20+/t21-,23-,24-,25-,27-,28+,29+/m1/s1 |
| InChIKey | DUWSVKKIWZLERT-QBOLNXKQSA-N |
| XLogP | 8.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.00 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|