C32H62O6Si2 — CID 15602515
(2R,3S,4S,6E,8R,9S,10R,11E,13R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-2,4,8,10,12-pentamethyl-5-oxopentadeca-6,11-dienoic acid (PubChem CID 15602515) has the molecular formula C32H62O6Si2 and a molecular weight of 599.01 g/mol. Its IUPAC name is (2R,3S,4S,6E,8R,9S,10R,11E,13R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-2,4,8,10,12-pentamethyl-5-oxopentadeca-6,11-dienoic acid.
| Compound Name | (2R,3S,4S,6E,8R,9S,10R,11E,13R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-2,4,8,10,12-pentamethyl-5-oxopentadeca-6,11-dienoic acid |
|---|---|
| PubChem CID | 15602515 |
| Molecular Formula | C32H62O6Si2 |
| Molecular Weight | 599.01 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | (2R,3S,4S,6E,8R,9S,10R,11E,13R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-2,4,8,10,12-pentamethyl-5-oxopentadeca-6,11-dienoic acid |
| SMILES | CC[C@@H](O)/C(C)=C/[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/C(=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C32H62O6Si2/c1-17-26(33)22(3)20-23(4)28(37-39(13,14)31(7,8)9)21(2)18-19-27(34)24(5)29(25(6)30(35)36)38-40(15,16)32(10,11)12/h18-21,23-26,28-29,33H,17H2,1-16H3,(H,35,36)/b19-18+,22-20+/t21-,23-,24-,25-,26-,28+,29+/m1/s1 |
| InChIKey | BARLBMUQXUHRKV-QUBMJRAXSA-N |
| XLogP | 8.24 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.01 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|