C37H76O7Si3 — CID 102370323
methyl (Z,2R,3S,4R,7R,10S,11S,12S,13S)-3,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,10,12-tetramethyl-5-oxotetradec-8-enoate (PubChem CID 102370323) has the molecular formula C37H76O7Si3 and a molecular weight of 717.27 g/mol. Its IUPAC name is methyl (Z,2R,3S,4R,7R,10S,11S,12S,13S)-3,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,10,12-tetramethyl-5-oxotetradec-8-enoate.
| Compound Name | methyl (Z,2R,3S,4R,7R,10S,11S,12S,13S)-3,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,10,12-tetramethyl-5-oxotetradec-8-enoate |
|---|---|
| PubChem CID | 102370323 |
| Molecular Formula | C37H76O7Si3 |
| Molecular Weight | 717.27 g/mol |
| Exact Mass | 716.49 |
| IUPAC Name | methyl (Z,2R,3S,4R,7R,10S,11S,12S,13S)-3,11,13-tris[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,10,12-tetramethyl-5-oxotetradec-8-enoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C[C@@H](O)/C=C\[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H76O7Si3/c1-25(32(43-46(18,19)36(9,10)11)26(2)29(5)42-45(16,17)35(6,7)8)22-23-30(38)24-31(39)27(3)33(28(4)34(40)41-15)44-47(20,21)37(12,13)14/h22-23,25-30,32-33,38H,24H2,1-21H3/b23-22-/t25-,26-,27-,28+,29-,30-,32-,33-/m0/s1 |
| InChIKey | GDQPLOMJFPMQGV-SJOZTBLVSA-N |
| XLogP | 9.77 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.27 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|