C38H74O7Si3 — CID 134942311
methyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate (PubChem CID 134942311) has the molecular formula C38H74O7Si3 and a molecular weight of 727.26 g/mol. Its IUPAC name is methyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate.
| Compound Name | methyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate |
|---|---|
| PubChem CID | 134942311 |
| Molecular Formula | C38H74O7Si3 |
| Molecular Weight | 727.26 g/mol |
| Exact Mass | 726.47 |
| IUPAC Name | methyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate |
| SMILES | COC(=O)CC(=O)C[C@H](C[C@H](C/C=C/C=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C/C=C/CO)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H74O7Si3/c1-30(23-21-22-26-39)34(45-48(16,17)38(8,9)10)25-20-18-19-24-32(43-46(12,13)36(2,3)4)29-33(27-31(40)28-35(41)42-11)44-47(14,15)37(5,6)7/h18-22,25,30,32-34,39H,23-24,26-29H2,1-17H3/b19-18+,22-21+,25-20-/t30-,32+,33-,34+/m1/s1 |
| InChIKey | ZXTPEYSNYOBALT-DWEQQWMHSA-N |
| XLogP | 10.15 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.26 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|