C34H64O7Si — CID 134872622
2-[(2S,4R,6S)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2S)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid (PubChem CID 134872622) has the molecular formula C34H64O7Si and a molecular weight of 612.97 g/mol. Its IUPAC name is 2-[(2S,4R,6S)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2S)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,4R,6S)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2S)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 134872622 |
| Molecular Formula | C34H64O7Si |
| Molecular Weight | 612.97 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | 2-[(2S,4R,6S)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2S)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid |
| SMILES | CO[C@@H](C[C@H]1C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](CC(=O)O)O1)C[C@H]1O[C@H](C[C@H](O)/C=C/CC(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C34H64O7Si/c1-22(2)12-11-13-27(35)16-28-15-14-26(9)33(40-28)20-29(38-10)17-30-18-32(19-31(39-30)21-34(36)37)41-42(23(3)4,24(5)6)25(7)8/h11,13,22-33,35H,12,14-21H2,1-10H3,(H,36,37)/b13-11+/t26-,27+,28-,29-,30-,31-,32+,33+/m0/s1 |
| InChIKey | JJFJMGGFJVQYPL-FHYGEVDLSA-N |
| XLogP | 7.90 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.97 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|