C21H40O5Si2 — CID 134931472
[tert-butyl(dimethyl)silyl] 2-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]acetate (PubChem CID 134931472) has the molecular formula C21H40O5Si2 and a molecular weight of 428.72 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]acetate |
|---|---|
| PubChem CID | 134931472 |
| Molecular Formula | C21H40O5Si2 |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]acetate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H]1OCC=C[C@H]1CC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O5Si2/c1-20(2,3)27(7,8)25-18(22)14-16-12-11-13-24-17(16)15-19(23)26-28(9,10)21(4,5)6/h11-12,16-17H,13-15H2,1-10H3/t16-,17-/m0/s1 |
| InChIKey | DPYMPNVTEOCERW-IRXDYDNUSA-N |
| XLogP | 5.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|