C28H50O5Si — CID 132992371
ethyl (2E,4S,5S,6S,8R,10E,12E,14S,15R)-5-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,6,8,14-tetramethyl-9-oxohexadeca-2,10,12-trienoate (PubChem CID 132992371) has the molecular formula C28H50O5Si and a molecular weight of 494.79 g/mol. Its IUPAC name is ethyl (2E,4S,5S,6S,8R,10E,12E,14S,15R)-5-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,6,8,14-tetramethyl-9-oxohexadeca-2,10,12-trienoate.
| Compound Name | ethyl (2E,4S,5S,6S,8R,10E,12E,14S,15R)-5-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,6,8,14-tetramethyl-9-oxohexadeca-2,10,12-trienoate |
|---|---|
| PubChem CID | 132992371 |
| Molecular Formula | C28H50O5Si |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | ethyl (2E,4S,5S,6S,8R,10E,12E,14S,15R)-5-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-4,6,8,14-tetramethyl-9-oxohexadeca-2,10,12-trienoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)C(=O)/C=C/C=C/[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C28H50O5Si/c1-12-32-26(31)18-17-21(3)27(33-34(10,11)28(7,8)9)23(5)19-22(4)25(30)16-14-13-15-20(2)24(6)29/h13-18,20-24,27,29H,12,19H2,1-11H3/b15-13+,16-14+,18-17+/t20-,21-,22+,23-,24+,27+/m0/s1 |
| InChIKey | DOXZDIYXZJXFPT-CLEFOGMTSA-N |
| XLogP | 6.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|