C19H32O3Si — CID 11823920
[(E,1S,3R)-3,4-dimethyl-1-(6-oxocyclohexen-1-yl)-6-trimethylsilylhex-4-enyl] acetate (PubChem CID 11823920) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is [(E,1S,3R)-3,4-dimethyl-1-(6-oxocyclohexen-1-yl)-6-trimethylsilylhex-4-enyl] acetate.
| Compound Name | [(E,1S,3R)-3,4-dimethyl-1-(6-oxocyclohexen-1-yl)-6-trimethylsilylhex-4-enyl] acetate |
|---|---|
| PubChem CID | 11823920 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | [(E,1S,3R)-3,4-dimethyl-1-(6-oxocyclohexen-1-yl)-6-trimethylsilylhex-4-enyl] acetate |
| SMILES | CC(=O)O[C@@H](C[C@@H](C)/C(C)=C/C[Si](C)(C)C)C1=CCCCC1=O |
| InChI | InChI=1S/C19H32O3Si/c1-14(11-12-23(4,5)6)15(2)13-19(22-16(3)20)17-9-7-8-10-18(17)21/h9,11,15,19H,7-8,10,12-13H2,1-6H3/b14-11+/t15-,19+/m1/s1 |
| InChIKey | QAGUCAKOVOHEEM-NDVVBYJMSA-N |
| XLogP | 4.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|