C29H45FO4 — CID 142948665
(3E,7E,10S,11R,12Z)-14-[(2S)-6-cycloheptyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one (PubChem CID 142948665) has the molecular formula C29H45FO4 and a molecular weight of 476.67 g/mol. Its IUPAC name is (3E,7E,10S,11R,12Z)-14-[(2S)-6-cycloheptyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one.
| Compound Name | (3E,7E,10S,11R,12Z)-14-[(2S)-6-cycloheptyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
|---|---|
| PubChem CID | 142948665 |
| Molecular Formula | C29H45FO4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | (3E,7E,10S,11R,12Z)-14-[(2S)-6-cycloheptyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
| SMILES | COC1/C=C/CC/C=C/C(=O)OC([C@H](C)C(=O)CCCC2CCCCCC2)/C(C)=C\[C@@H](C)[C@@H]1F |
| InChI | InChI=1S/C29H45FO4/c1-21-20-22(2)29(23(3)25(31)17-13-16-24-14-9-5-6-10-15-24)34-27(32)19-12-8-7-11-18-26(33-4)28(21)30/h11-12,18-21,23-24,26,28-29H,5-10,13-17H2,1-4H3/b18-11+,19-12+,22-20-/t21-,23-,26?,28+,29?/m1/s1 |
| InChIKey | UWKMFRZLORSNOT-IJFQFFEFSA-N |
| XLogP | 7.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|