C26H38O5 — CID 138970034
(7E,11E)-5-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,12,16-trimethylheptadeca-7,11,15-triene-2,4-dione (PubChem CID 138970034) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (7E,11E)-5-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,12,16-trimethylheptadeca-7,11,15-triene-2,4-dione.
| Compound Name | (7E,11E)-5-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,12,16-trimethylheptadeca-7,11,15-triene-2,4-dione |
|---|---|
| PubChem CID | 138970034 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (7E,11E)-5-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,12,16-trimethylheptadeca-7,11,15-triene-2,4-dione |
| SMILES | CC(=O)CC(=O)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C26H38O5/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-15-22(23(28)16-21(5)27)24-17-25(29)31-26(6,7)30-24/h10,12,14,17,22H,8-9,11,13,15-16H2,1-7H3/b19-12+,20-14+ |
| InChIKey | RBDYMPACRYLLJA-LCAIAVFMSA-N |
| XLogP | 6.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|