C27H38O8 — CID 134951614
[(2E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl] 2-acetyl-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate (PubChem CID 134951614) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is [(2E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl] 2-acetyl-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate.
| Compound Name | [(2E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl] 2-acetyl-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 134951614 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [(2E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl] 2-acetyl-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
| SMILES | CC(=O)C(C(=O)CC1=CC(=O)OC(C)(C)O1)C(=O)OC/C=C(\C)CCC=C(C)CC[C@@H]1OC1(C)C |
| InChI | InChI=1S/C27H38O8/c1-17(11-12-22-26(4,5)34-22)9-8-10-18(2)13-14-32-25(31)24(19(3)28)21(29)15-20-16-23(30)35-27(6,7)33-20/h9,13,16,22,24H,8,10-12,14-15H2,1-7H3/b17-9?,18-13+/t22-,24?/m0/s1 |
| InChIKey | NNVFUZLQAOBHDD-GCTPYUJBSA-N |
| XLogP | 4.52 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|