C12H18O4 — CID 71533903
2,2-dimethyl-6-(4-methyl-2-oxopentyl)-1,3-dioxin-4-one (PubChem CID 71533903) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-methyl-2-oxopentyl)-1,3-dioxin-4-one.
| Compound Name | 2,2-dimethyl-6-(4-methyl-2-oxopentyl)-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 71533903 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,2-dimethyl-6-(4-methyl-2-oxopentyl)-1,3-dioxin-4-one |
| SMILES | CC(C)CC(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C12H18O4/c1-8(2)5-9(13)6-10-7-11(14)16-12(3,4)15-10/h7-8H,5-6H2,1-4H3 |
| InChIKey | MYEVULSMPUWJQM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |