C11H18O3 — CID 139754293
2,2-dimethyl-6-(3-methylbutyl)-1,3-dioxin-4-one (PubChem CID 139754293) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2,2-dimethyl-6-(3-methylbutyl)-1,3-dioxin-4-one.
| Compound Name | 2,2-dimethyl-6-(3-methylbutyl)-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 139754293 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2,2-dimethyl-6-(3-methylbutyl)-1,3-dioxin-4-one |
| SMILES | CC(C)CCC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C11H18O3/c1-8(2)5-6-9-7-10(12)14-11(3,4)13-9/h7-8H,5-6H2,1-4H3 |
| InChIKey | AHQXBDXOYHKBQZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |