About 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one
2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one (PubChem CID 11206618) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one.
Analyze 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one?
The IUPAC name of 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one (CID 11206618) is 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one.
What is the SMILES notation for 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one?
The canonical SMILES for 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one is CC(C)C(=O)CC1=CC(=O)OC(C)(C)O1.
What is the InChIKey of 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one?
The InChIKey is GPYRYZXNYYCUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-7(2)9(12)5-8-6-10(13)15-11(3,4)14-8/h6-7H,5H2,1-4H3.
What are the key properties of 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one?
2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one has a molecular weight of 212.24 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(3-methyl-2-oxobutyl)-1,3-dioxin-4-one is sourced from PubChem (CID 11206618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).