C11H14O5 — CID 45103272
1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)pentane-2,4-dione (PubChem CID 45103272) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)pentane-2,4-dione.
| Compound Name | 1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)pentane-2,4-dione |
|---|---|
| PubChem CID | 45103272 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)pentane-2,4-dione |
| SMILES | CC(=O)CC(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C11H14O5/c1-7(12)4-8(13)5-9-6-10(14)16-11(2,3)15-9/h6H,4-5H2,1-3H3 |
| InChIKey | ORAAYGMZMCIPTB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|