C14H20O6 — CID 12038446
tert-butyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate (PubChem CID 12038446) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate.
| Compound Name | tert-butyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 12038446 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | tert-butyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C14H20O6/c1-13(2,3)19-11(16)7-9(15)6-10-8-12(17)20-14(4,5)18-10/h8H,6-7H2,1-5H3 |
| InChIKey | LYESXTBZKMGWMM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|