C13H16O6 — CID 44518232
prop-2-enyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate (PubChem CID 44518232) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is prop-2-enyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate.
| Compound Name | prop-2-enyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 44518232 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | prop-2-enyl 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
| SMILES | C=CCOC(=O)CC(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C13H16O6/c1-4-5-17-11(15)7-9(14)6-10-8-12(16)19-13(2,3)18-10/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | HIHVSJTZRYUGIN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|