C13H18O5 — CID 15536940
ethyl 2-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]prop-2-enoate (PubChem CID 15536940) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is ethyl 2-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 15536940 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethyl 2-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]prop-2-enoate |
| SMILES | C=C(CC1=C(C)OC(C)(C)OC1=O)C(=O)OCC |
| InChI | InChI=1S/C13H18O5/c1-6-16-11(14)8(2)7-10-9(3)17-13(4,5)18-12(10)15/h2,6-7H2,1,3-5H3 |
| InChIKey | CPJKURXFDZSWKT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|