C26H46O5Si — CID 135010178
ethyl (4E)-2-[5-[tert-butyl(dimethyl)silyl]oxy-3-oxohexanoyl]-5,9-dimethyldeca-4,8-dienoate (PubChem CID 135010178) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is ethyl (4E)-2-[5-[tert-butyl(dimethyl)silyl]oxy-3-oxohexanoyl]-5,9-dimethyldeca-4,8-dienoate.
| Compound Name | ethyl (4E)-2-[5-[tert-butyl(dimethyl)silyl]oxy-3-oxohexanoyl]-5,9-dimethyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 135010178 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | ethyl (4E)-2-[5-[tert-butyl(dimethyl)silyl]oxy-3-oxohexanoyl]-5,9-dimethyldeca-4,8-dienoate |
| SMILES | CCOC(=O)C(C/C=C(\C)CCC=C(C)C)C(=O)CC(=O)CC(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O5Si/c1-11-30-25(29)23(16-15-20(4)14-12-13-19(2)3)24(28)18-22(27)17-21(5)31-32(9,10)26(6,7)8/h13,15,21,23H,11-12,14,16-18H2,1-10H3/b20-15+ |
| InChIKey | LAUHXWCPGIIUEB-HMMYKYKNSA-N |
| XLogP | 6.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|