C31H52O5Si — CID 134932250
methyl 5-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]-2,4-dimethyl-3,5-dioxopentanoate (PubChem CID 134932250) has the molecular formula C31H52O5Si and a molecular weight of 532.84 g/mol. Its IUPAC name is methyl 5-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]-2,4-dimethyl-3,5-dioxopentanoate.
| Compound Name | methyl 5-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]-2,4-dimethyl-3,5-dioxopentanoate |
|---|---|
| PubChem CID | 134932250 |
| Molecular Formula | C31H52O5Si |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | methyl 5-[(1S,4S,5R,6S)-4-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-2-yl]-1,3,6-trimethyl-6-bicyclo[3.1.0]hex-2-enyl]-2,4-dimethyl-3,5-dioxopentanoate |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)[C@H]1C(C)=C[C@@]2(C)[C@@H]1[C@]2(C)C(=O)C(C)C(=O)C(C)C(=O)OC |
| InChI | InChI=1S/C31H52O5Si/c1-15-23(36-37(13,14)29(7,8)9)18(2)16-19(3)24-20(4)17-30(10)26(24)31(30,11)27(33)21(5)25(32)22(6)28(34)35-12/h16-18,21-24,26H,15H2,1-14H3/b19-16+/t18-,21?,22?,23-,24+,26-,30+,31-/m1/s1 |
| InChIKey | WFEKKOXIMIBWBG-WTEPWVTRSA-N |
| XLogP | 7.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|