C21H42O5Si — CID 11235051
dimethyl 2-[(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl]propanedioate (PubChem CID 11235051) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is dimethyl 2-[(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl]propanedioate.
| Compound Name | dimethyl 2-[(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl]propanedioate |
|---|---|
| PubChem CID | 11235051 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | dimethyl 2-[(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl]propanedioate |
| SMILES | CC[C@H](C)C[C@@H](CC(C(=O)OC)C(=O)OC)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O5Si/c1-11-15(3)13-16(14-17(19(22)24-7)20(23)25-8)18(12-2)26-27(9,10)21(4,5)6/h15-18H,11-14H2,1-10H3/t15-,16-,18+/m0/s1 |
| InChIKey | NUNJJKNPOYXIRC-XYJFISCASA-N |
| XLogP | 5.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|