C20H40O3Si — CID 11494160
(E,2S,4R,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,4,8-trimethylundec-6-en-5-one (PubChem CID 11494160) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is (E,2S,4R,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,4,8-trimethylundec-6-en-5-one.
| Compound Name | (E,2S,4R,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,4,8-trimethylundec-6-en-5-one |
|---|---|
| PubChem CID | 11494160 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (E,2S,4R,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,4,8-trimethylundec-6-en-5-one |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/C(=O)[C@H](C)C[C@H](C)CO |
| InChI | InChI=1S/C20H40O3Si/c1-10-19(23-24(8,9)20(5,6)7)16(3)11-12-18(22)17(4)13-15(2)14-21/h11-12,15-17,19,21H,10,13-14H2,1-9H3/b12-11+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | DNTDECBKPOHGCL-HTGUDJHRSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|