C21H44O3Si — CID 11417434
[(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 2,2-dimethylpropanoate (PubChem CID 11417434) has the molecular formula C21H44O3Si and a molecular weight of 372.67 g/mol. Its IUPAC name is [(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11417434 |
| Molecular Formula | C21H44O3Si |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | [(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 2,2-dimethylpropanoate |
| SMILES | CC[C@H](C)C[C@@H](COC(=O)C(C)(C)C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O3Si/c1-12-16(3)14-17(15-23-19(22)20(4,5)6)18(13-2)24-25(10,11)21(7,8)9/h16-18H,12-15H2,1-11H3/t16-,17-,18+/m0/s1 |
| InChIKey | YXSZBLKCVPREDX-OKZBNKHCSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|