C24H48O6Si — CID 10766407
[(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyl-9-oxononyl] 2,2-dimethylpropanoate (PubChem CID 10766407) has the molecular formula C24H48O6Si and a molecular weight of 460.73 g/mol. Its IUPAC name is [(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyl-9-oxononyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyl-9-oxononyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10766407 |
| Molecular Formula | C24H48O6Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyl-9-oxononyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@H](CCOC(=O)C(C)(C)C)[C@H](C)[C@@H](C[C@@H](OC)[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O6Si/c1-17(16-25)20(28-10)15-21(30-31(11,12)24(6,7)8)18(2)19(27-9)13-14-29-22(26)23(3,4)5/h16-21H,13-15H2,1-12H3/t17-,18-,19+,20+,21+/m0/s1 |
| InChIKey | QNUHGKAULSBFKI-WRTQPQOASA-N |
| XLogP | 5.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|