C17H33BrO4Si — CID 16753972
[(3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-oxoheptan-3-yl] 2-bromopropanoate (PubChem CID 16753972) has the molecular formula C17H33BrO4Si and a molecular weight of 409.44 g/mol. Its IUPAC name is [(3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-oxoheptan-3-yl] 2-bromopropanoate.
| Compound Name | [(3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-oxoheptan-3-yl] 2-bromopropanoate |
|---|---|
| PubChem CID | 16753972 |
| Molecular Formula | C17H33BrO4Si |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-oxoheptan-3-yl] 2-bromopropanoate |
| SMILES | CC[C@@H](OC(=O)C(C)Br)[C@H](C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33BrO4Si/c1-9-14(21-16(20)13(3)18)12(2)15(10-11-19)22-23(7,8)17(4,5)6/h11-15H,9-10H2,1-8H3/t12-,13?,14+,15-/m0/s1 |
| InChIKey | QAGMLVCBKMAXBF-LRMYVUMKSA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|