C21H42O4Si — CID 102142959
methyl (E,5S,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyldec-2-enoate (PubChem CID 102142959) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is methyl (E,5S,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyldec-2-enoate.
| Compound Name | methyl (E,5S,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyldec-2-enoate |
|---|---|
| PubChem CID | 102142959 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | methyl (E,5S,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyldec-2-enoate |
| SMILES | CC[C@H](C)[C@@H](OC)[C@@H](C)[C@H](C/C=C(\C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si/c1-12-15(2)19(23-8)17(4)18(14-13-16(3)20(22)24-9)25-26(10,11)21(5,6)7/h13,15,17-19H,12,14H2,1-11H3/b16-13+/t15-,17-,18-,19+/m0/s1 |
| InChIKey | SNWAELIWDVXHPQ-HTJXHCOPSA-N |
| XLogP | 5.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|