C25H52O4Si — CID 158849082
(E,3R,4R,5S,6S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9-trimethyltetradec-7-en-6-ol (PubChem CID 158849082) has the molecular formula C25H52O4Si and a molecular weight of 444.77 g/mol. Its IUPAC name is (E,3R,4R,5S,6S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9-trimethyltetradec-7-en-6-ol.
| Compound Name | (E,3R,4R,5S,6S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9-trimethyltetradec-7-en-6-ol |
|---|---|
| PubChem CID | 158849082 |
| Molecular Formula | C25H52O4Si |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (E,3R,4R,5S,6S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9-trimethyltetradec-7-en-6-ol |
| SMILES | CC[C@H](C[C@H](OC)[C@@H](C)/C=C/[C@H](O)[C@H](C)[C@H](OC)[C@H](C)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O4Si/c1-13-18(3)24(28-10)20(5)22(26)16-15-19(4)23(27-9)17-21(14-2)29-30(11,12)25(6,7)8/h15-16,18-24,26H,13-14,17H2,1-12H3/b16-15+/t18-,19+,20+,21-,22+,23+,24-/m1/s1 |
| InChIKey | IZFFRIWELIOAMN-HRFLSEQLSA-N |
| XLogP | 6.44 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|