C28H55IO5Si — CID 155619149
[(E,3R,4R,5S,6R,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] propanoate (PubChem CID 155619149) has the molecular formula C28H55IO5Si and a molecular weight of 626.73 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] propanoate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] propanoate |
|---|---|
| PubChem CID | 155619149 |
| Molecular Formula | C28H55IO5Si |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] propanoate |
| SMILES | CCC(=O)O[C@H](CC[C@H](C)[C@H](C[C@@H](CC)O[Si](C)(C)C(C)(C)C)OC)[C@H](C)[C@H](OC)[C@H](C)/C=C/I |
| InChI | InChI=1S/C28H55IO5Si/c1-13-23(34-35(11,12)28(6,7)8)19-25(31-9)20(3)15-16-24(33-26(30)14-2)22(5)27(32-10)21(4)17-18-29/h17-18,20-25,27H,13-16,19H2,1-12H3/b18-17+/t20-,21+,22-,23+,24+,25-,27+/m0/s1 |
| InChIKey | WRYXQWREJCFIAC-RSIWTNMQSA-N |
| XLogP | 8.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|