C24H45IO5 — CID 155142844
[(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] 2-methylpropanoate (PubChem CID 155142844) has the molecular formula C24H45IO5 and a molecular weight of 540.52 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] 2-methylpropanoate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155142844 |
| Molecular Formula | C24H45IO5 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] 2-methylpropanoate |
| SMILES | CO[C@@H]([C@@H](C)[C@@H](CC[C@H](C)[C@H](C[C@H](O)C(C)C)OC)OC(=O)C(C)C)[C@H](C)/C=C/I |
| InChI | InChI=1S/C24H45IO5/c1-15(2)20(26)14-22(28-8)17(5)10-11-21(30-24(27)16(3)4)19(7)23(29-9)18(6)12-13-25/h12-13,15-23,26H,10-11,14H2,1-9H3/b13-12+/t17-,18+,19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | DJLJUZSLBHNYDV-DSVXYXRYSA-N |
| XLogP | 5.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|