C32H56O12 — CID 100981352
[(3R,4R,5S,6R,9R,10S,12S,13R,14S)-4,6,12,16-tetraacetyloxy-10,14-dimethoxy-3,5,9,13-tetramethylhexadecyl] acetate (PubChem CID 100981352) has the molecular formula C32H56O12 and a molecular weight of 632.79 g/mol. Its IUPAC name is [(3R,4R,5S,6R,9R,10S,12S,13R,14S)-4,6,12,16-tetraacetyloxy-10,14-dimethoxy-3,5,9,13-tetramethylhexadecyl] acetate.
| Compound Name | [(3R,4R,5S,6R,9R,10S,12S,13R,14S)-4,6,12,16-tetraacetyloxy-10,14-dimethoxy-3,5,9,13-tetramethylhexadecyl] acetate |
|---|---|
| PubChem CID | 100981352 |
| Molecular Formula | C32H56O12 |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.38 |
| IUPAC Name | [(3R,4R,5S,6R,9R,10S,12S,13R,14S)-4,6,12,16-tetraacetyloxy-10,14-dimethoxy-3,5,9,13-tetramethylhexadecyl] acetate |
| SMILES | CO[C@@H](CCOC(C)=O)[C@@H](C)[C@H](C[C@H](OC)[C@H](C)CC[C@@H](OC(C)=O)[C@H](C)[C@H](OC(C)=O)[C@H](C)CCOC(C)=O)OC(C)=O |
| InChI | InChI=1S/C32H56O12/c1-19(30(39-11)18-31(43-26(8)36)21(3)28(38-10)15-17-41-24(6)34)12-13-29(42-25(7)35)22(4)32(44-27(9)37)20(2)14-16-40-23(5)33/h19-22,28-32H,12-18H2,1-11H3/t19-,20-,21-,22+,28+,29-,30+,31+,32-/m1/s1 |
| InChIKey | MGRZNACXIHMSMR-GIKBNEMASA-N |
| XLogP | 4.43 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|