C15H21F3O12S — CID 90054288
[3,4,6-triacetyloxy-6-hydroxy-5-(trifluoromethylsulfonyloxy)hexyl] acetate (PubChem CID 90054288) has the molecular formula C15H21F3O12S and a molecular weight of 482.38 g/mol. Its IUPAC name is [3,4,6-triacetyloxy-6-hydroxy-5-(trifluoromethylsulfonyloxy)hexyl] acetate.
| Compound Name | [3,4,6-triacetyloxy-6-hydroxy-5-(trifluoromethylsulfonyloxy)hexyl] acetate |
|---|---|
| PubChem CID | 90054288 |
| Molecular Formula | C15H21F3O12S |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | [3,4,6-triacetyloxy-6-hydroxy-5-(trifluoromethylsulfonyloxy)hexyl] acetate |
| SMILES | CC(=O)OCCC(OC(C)=O)C(OC(C)=O)C(OS(=O)(=O)C(F)(F)F)C(O)OC(C)=O |
| InChI | InChI=1S/C15H21F3O12S/c1-7(19)26-6-5-11(27-8(2)20)12(28-9(3)21)13(14(23)29-10(4)22)30-31(24,25)15(16,17)18/h11-14,23H,5-6H2,1-4H3 |
| InChIKey | COCXAFSKUJIVKH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|