C16H24O9S — CID 10763085
[(3R,4S,5S)-3,4,5-triacetyloxy-6-acetylsulfanylhexyl] acetate (PubChem CID 10763085) has the molecular formula C16H24O9S and a molecular weight of 392.43 g/mol. Its IUPAC name is [(3R,4S,5S)-3,4,5-triacetyloxy-6-acetylsulfanylhexyl] acetate.
| Compound Name | [(3R,4S,5S)-3,4,5-triacetyloxy-6-acetylsulfanylhexyl] acetate |
|---|---|
| PubChem CID | 10763085 |
| Molecular Formula | C16H24O9S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [(3R,4S,5S)-3,4,5-triacetyloxy-6-acetylsulfanylhexyl] acetate |
| SMILES | CC(=O)OCC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](CSC(C)=O)OC(C)=O |
| InChI | InChI=1S/C16H24O9S/c1-9(17)22-7-6-14(23-10(2)18)16(25-12(4)20)15(24-11(3)19)8-26-13(5)21/h14-16H,6-8H2,1-5H3/t14-,15-,16+/m1/s1 |
| InChIKey | AUXKIVOPOKEMQL-OAGGEKHMSA-N |
| XLogP | 1.01 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|