C12H21NO7 — CID 123368932
(4,5-diacetyloxy-1-amino-6-hydroxyhexan-3-yl) acetate (PubChem CID 123368932) has the molecular formula C12H21NO7 and a molecular weight of 291.30 g/mol. Its IUPAC name is (4,5-diacetyloxy-1-amino-6-hydroxyhexan-3-yl) acetate.
| Compound Name | (4,5-diacetyloxy-1-amino-6-hydroxyhexan-3-yl) acetate |
|---|---|
| PubChem CID | 123368932 |
| Molecular Formula | C12H21NO7 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (4,5-diacetyloxy-1-amino-6-hydroxyhexan-3-yl) acetate |
| SMILES | CC(=O)OC(CO)C(OC(C)=O)C(CCN)OC(C)=O |
| InChI | InChI=1S/C12H21NO7/c1-7(15)18-10(4-5-13)12(20-9(3)17)11(6-14)19-8(2)16/h10-12,14H,4-6,13H2,1-3H3 |
| InChIKey | OBROUTDIPHZDKF-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|