C14H19BrO10 — CID 22852311
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxy-1-oxohexan-2-yl] 2-bromoacetate (PubChem CID 22852311) has the molecular formula C14H19BrO10 and a molecular weight of 427.20 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxy-1-oxohexan-2-yl] 2-bromoacetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxy-1-oxohexan-2-yl] 2-bromoacetate |
|---|---|
| PubChem CID | 22852311 |
| Molecular Formula | C14H19BrO10 |
| Molecular Weight | 427.20 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxy-1-oxohexan-2-yl] 2-bromoacetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@H](C=O)OC(=O)CBr)[C@@H](CO)OC(C)=O |
| InChI | InChI=1S/C14H19BrO10/c1-7(18)22-10(5-16)13(23-8(2)19)14(24-9(3)20)11(6-17)25-12(21)4-15/h6,10-11,13-14,16H,4-5H2,1-3H3/t10-,11+,13+,14-/m1/s1 |
| InChIKey | BBZYNULEBAFQIG-UVLXDEKHSA-N |
| XLogP | -0.72 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|