C14H22O9 — CID 89196523
(3,4,5-triacetyloxy-6-hydroxyhexan-2-yl) acetate (PubChem CID 89196523) has the molecular formula C14H22O9 and a molecular weight of 334.32 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-hydroxyhexan-2-yl) acetate.
| Compound Name | (3,4,5-triacetyloxy-6-hydroxyhexan-2-yl) acetate |
|---|---|
| PubChem CID | 89196523 |
| Molecular Formula | C14H22O9 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (3,4,5-triacetyloxy-6-hydroxyhexan-2-yl) acetate |
| SMILES | CC(=O)OC(C)C(OC(C)=O)C(OC(C)=O)C(CO)OC(C)=O |
| InChI | InChI=1S/C14H22O9/c1-7(20-8(2)16)13(22-10(4)18)14(23-11(5)19)12(6-15)21-9(3)17/h7,12-15H,6H2,1-5H3 |
| InChIKey | QIEVCJAHELLNFE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|