C14H19ClO9 — CID 140545147
[(2R,3S,4R,5S)-3,4,5-triacetyloxy-1-chloro-6-oxohexan-2-yl] acetate (PubChem CID 140545147) has the molecular formula C14H19ClO9 and a molecular weight of 366.75 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4,5-triacetyloxy-1-chloro-6-oxohexan-2-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-3,4,5-triacetyloxy-1-chloro-6-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 140545147 |
| Molecular Formula | C14H19ClO9 |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4,5-triacetyloxy-1-chloro-6-oxohexan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@H](CCl)OC(C)=O)[C@@H](C=O)OC(C)=O |
| InChI | InChI=1S/C14H19ClO9/c1-7(17)21-11(5-15)13(23-9(3)19)14(24-10(4)20)12(6-16)22-8(2)18/h6,11-14H,5H2,1-4H3/t11-,12+,13+,14-/m0/s1 |
| InChIKey | DCONQCVLFVNDLG-DGAVXFQQSA-N |
| XLogP | 0.15 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|