C12H17BrO8 — CID 121011851
[(2R,3S,4R,5S)-3,4-diacetyloxy-6-bromo-5-hydroxy-1-oxohexan-2-yl] acetate (PubChem CID 121011851) has the molecular formula C12H17BrO8 and a molecular weight of 369.16 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-diacetyloxy-6-bromo-5-hydroxy-1-oxohexan-2-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-3,4-diacetyloxy-6-bromo-5-hydroxy-1-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 121011851 |
| Molecular Formula | C12H17BrO8 |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-diacetyloxy-6-bromo-5-hydroxy-1-oxohexan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]([C@H](OC(C)=O)[C@H](C=O)OC(C)=O)[C@H](O)CBr |
| InChI | InChI=1S/C12H17BrO8/c1-6(15)19-10(5-14)12(21-8(3)17)11(9(18)4-13)20-7(2)16/h5,9-12,18H,4H2,1-3H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | NZAIDMVNBHLDFY-WRWGMCAJSA-N |
| XLogP | -0.26 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|