C17H28O8 — CID 137357148
[(2R,3R,4R)-3,4-di(butanoyloxy)-1-hydroxy-5-oxopentan-2-yl] butanoate (PubChem CID 137357148) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-di(butanoyloxy)-1-hydroxy-5-oxopentan-2-yl] butanoate.
| Compound Name | [(2R,3R,4R)-3,4-di(butanoyloxy)-1-hydroxy-5-oxopentan-2-yl] butanoate |
|---|---|
| PubChem CID | 137357148 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(2R,3R,4R)-3,4-di(butanoyloxy)-1-hydroxy-5-oxopentan-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]([C@H](C=O)OC(=O)CCC)[C@@H](CO)OC(=O)CCC |
| InChI | InChI=1S/C17H28O8/c1-4-7-14(20)23-12(10-18)17(25-16(22)9-6-3)13(11-19)24-15(21)8-5-2/h10,12-13,17,19H,4-9,11H2,1-3H3/t12-,13+,17-/m0/s1 |
| InChIKey | FOZPLTDETSYMOJ-AHIWAGSCSA-N |
| XLogP | 1.31 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|