C30H50O12 — CID 87451251
[(2R,3R,4R,5R)-2,3,4,5,6-penta(butanoyloxy)hexyl] butanoate (PubChem CID 87451251) has the molecular formula C30H50O12 and a molecular weight of 602.72 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5,6-penta(butanoyloxy)hexyl] butanoate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5,6-penta(butanoyloxy)hexyl] butanoate |
|---|---|
| PubChem CID | 87451251 |
| Molecular Formula | C30H50O12 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5,6-penta(butanoyloxy)hexyl] butanoate |
| SMILES | CCCC(=O)OC[C@@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@@H](COC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C30H50O12/c1-7-13-23(31)37-19-21(39-25(33)15-9-3)29(41-27(35)17-11-5)30(42-28(36)18-12-6)22(40-26(34)16-10-4)20-38-24(32)14-8-2/h21-22,29-30H,7-20H2,1-6H3/t21-,22-,29-,30-/m1/s1 |
| InChIKey | KCRIBFYGAZERKL-IKTNGCAPSA-N |
| XLogP | 4.52 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|