C27H44O12 — CID 19426517
2,3-di(butanoyloxy)propyl 5,6,7-tri(propanoyloxy)heptanoate (PubChem CID 19426517) has the molecular formula C27H44O12 and a molecular weight of 560.64 g/mol. Its IUPAC name is 2,3-di(butanoyloxy)propyl 5,6,7-tri(propanoyloxy)heptanoate.
| Compound Name | 2,3-di(butanoyloxy)propyl 5,6,7-tri(propanoyloxy)heptanoate |
|---|---|
| PubChem CID | 19426517 |
| Molecular Formula | C27H44O12 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2,3-di(butanoyloxy)propyl 5,6,7-tri(propanoyloxy)heptanoate |
| SMILES | CCCC(=O)OCC(COC(=O)CCCC(OC(=O)CC)C(COC(=O)CC)OC(=O)CC)OC(=O)CCC |
| InChI | InChI=1S/C27H44O12/c1-6-12-25(31)34-16-19(37-27(33)13-7-2)17-35-26(32)15-11-14-20(38-23(29)9-4)21(39-24(30)10-5)18-36-22(28)8-3/h19-21H,6-18H2,1-5H3 |
| InChIKey | HTMXQXUABZXYRJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|